CAS 50371-30-7 is the registry number for 2-(Bromomethyl)-1,4-naphthoquinone. Offered by: TRC. Available pack sizes: 100mg, 1g.
2-(bromomethyl)naphthalene-1,4-dione (CAS 50371-30-7) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 2-(bromomethyl)naphthalene-1,4-dione. InChIKey: VQWICJQAACGHEX-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 2-(bromomethyl)naphthalene-1,4-dione |
| InChIKey | VQWICJQAACGHEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(C2=O)CBr |
Computed by PubChem (NCBI)