CAS 503821-94-1 appears in our catalog under these names: 3-bromo-2-iodobenzoic acid, 3-Bromo-2-iodobenzoic acid 95%, 3-Bromo-2-iodobenzoic acid, 98%, 98%, 3-Bromo-2-iodobenzoic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g, 10g.
3-bromo-2-iodobenzoic acid (CAS 503821-94-1) is a chemical compound with the molecular formula C7H4BrIO2 and a molecular weight of 326.91 g/mol. IUPAC name: 3-bromo-2-iodobenzoic acid. InChIKey: RBFCXOXAEIWXRW-UHFFFAOYSA-N.
| Molecular formula | C7H4BrIO2 |
|---|---|
| Molecular weight | 326.91 g/mol |
| IUPAC name | 3-bromo-2-iodobenzoic acid |
| InChIKey | RBFCXOXAEIWXRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)I)C(=O)O |
Computed by PubChem (NCBI)