Products 50424-17-4
CAS 50424-17-4 is the registry number for 5-Amino-3-ethyl-1-phenyl-1H-pyrazole-4-carboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-amino-3-ethyl-1-phenylpyrazole-4-carboxamide (CAS 50424-17-4) is a chemical compound with the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. IUPAC name: 5-amino-3-ethyl-1-phenylpyrazole-4-carboxamide. InChIKey: KYAVGDMAAOMQOD-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O |
|---|---|
| Molecular weight | 230.27 g/mol |
| IUPAC name | 5-amino-3-ethyl-1-phenylpyrazole-4-carboxamide |
| InChIKey | KYAVGDMAAOMQOD-UHFFFAOYSA-N |
| SMILES | CCC1=NN(C(=C1C(=O)N)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)