CAS 50445-53-9 appears in our catalog under these names: N-Isopropyl-3-nitrobenzamide, 98%, N–Isopropyl–3–nitrobenzamide, N-Isopropyl-3-nitrobenzamide, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
3-nitro-N-propan-2-ylbenzamide (CAS 50445-53-9) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 3-nitro-N-propan-2-ylbenzamide. InChIKey: LAZHBIZCDHGGKL-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 3-nitro-N-propan-2-ylbenzamide |
| InChIKey | LAZHBIZCDHGGKL-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)