Products 50534-34-4
CAS 50534-34-4 is the registry number for 4-(Piperidin-4-Yl)Isoindoline-1,3-Dione Hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
4-piperidin-4-ylisoindole-1,3-dione;hydrochloride (CAS 50534-34-4) is a chemical compound with the molecular formula C13H15ClN2O2 and a molecular weight of 266.72 g/mol. IUPAC name: 4-piperidin-4-ylisoindole-1,3-dione;hydrochloride. InChIKey: CYGJLHBAMGKNNJ-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | 4-piperidin-4-ylisoindole-1,3-dione;hydrochloride |
| InChIKey | CYGJLHBAMGKNNJ-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=C3C(=CC=C2)C(=O)NC3=O.Cl |
Computed by PubChem (NCBI)