Products 50548-43-1
CAS 50548-43-1 appears in our catalog under these names: Dibenzo(b,d)furan–4–amine, Dibenzo[b,d]furan-4-amine, >98.0%(GC)(T), 4-Dibenzofuranamine 95%, 4-Dibenzofuranamine, 98%, 98%, 4-Dibenzofuranamine, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
Dibenzofuran-4-amine (CAS 50548-43-1) is a chemical compound with the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. IUPAC name: dibenzofuran-4-amine. InChIKey: QKBTTXJHJNXCOQ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | dibenzofuran-4-amine |
| InChIKey | QKBTTXJHJNXCOQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)N |
Computed by PubChem (NCBI)