CAS 5060-51-5 appears in our catalog under these names: 6-Hydroxy Methaqualone, >95% (HPLC), 6-Hydroxy methaqualone. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 2mg, 10mg, 25mg.
6-hydroxy-2-methyl-3-(2-methylphenyl)quinazolin-4-one (CAS 5060-51-5) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: 6-hydroxy-2-methyl-3-(2-methylphenyl)quinazolin-4-one. InChIKey: NHGHFELYOIWDRR-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 6-hydroxy-2-methyl-3-(2-methylphenyl)quinazolin-4-one |
| InChIKey | NHGHFELYOIWDRR-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C(=NC3=C(C2=O)C=C(C=C3)O)C |
Computed by PubChem (NCBI)