CAS 50704-43-3 appears in our catalog under these names: 6-O-Methyl-d3-guanine, >95% (HPLC), 6-O-Methyl-guanine-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
6-(trideuteriomethoxy)-7H-purin-2-amine (CAS 50704-43-3) is a chemical compound with the molecular formula C6H7N5O and a molecular weight of 168.17 g/mol. IUPAC name: 6-(trideuteriomethoxy)-7H-purin-2-amine. InChIKey: BXJHWYVXLGLDMZ-FIBGUPNXSA-N.
| Molecular formula | C6H7N5O |
|---|---|
| Molecular weight | 168.17 g/mol |
| IUPAC name | 6-(trideuteriomethoxy)-7H-purin-2-amine |
| InChIKey | BXJHWYVXLGLDMZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=NC(=NC2=C1NC=N2)N |
Computed by PubChem (NCBI)