CAS 50820-65-0 appears in our catalog under these names: Methyl indole-6-carboxylate, 98% , Indole-6-carboxylic acid methyl ester, Methyl Indole-6-carboxylate, >98.0%(GC), Methyl indole-6-carboxylate, 97%, Methyl 1H-indole-6-carboxylate 98%. Offered by: Thermo Scientific (Alfa Aesar), Biosynth, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 1g, 5g, 100g, 25g, 10g, 500g, 1000g, 1kg.
Methyl 1H-indole-6-carboxylate (CAS 50820-65-0) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: methyl 1H-indole-6-carboxylate. InChIKey: AYYOZKHMSABVRP-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | methyl 1H-indole-6-carboxylate |
| InChIKey | AYYOZKHMSABVRP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=CN2 |
Computed by PubChem (NCBI)