Products 508211-53-8

CAS 508211-53-8 is the registry number for 5-Amino-2-(phenylmethoxy)benzoic acid methyl ester. Offered by: Biosynth. Available pack sizes: 250mg, 100mg.

Structural formula: {0} (CAS {1})

Methyl 5-amino-2-phenylmethoxybenzoate (CAS 508211-53-8) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: methyl 5-amino-2-phenylmethoxybenzoate. InChIKey: YFDZYIYVWGWMNE-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15NO3
Molecular weight257.28 g/mol
IUPAC namemethyl 5-amino-2-phenylmethoxybenzoate
InChIKeyYFDZYIYVWGWMNE-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CC(=C1)N)OCC2=CC=CC=C2

Computed by PubChem (NCBI)