CAS 50824-05-0 appears in our catalog under these names: 4-Trifluoromethoxybenzyl Bromide, 4–(Trifluoromethoxy)benzyl bromide, 4-(Trifluoromethoxy)benzyl bromide, 97% , 4-(Trifluoromethoxy)benzyl Bromide, >98.0%(GC), 4-(Trifluoromethoxy)benzyl bromide, 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 10g, 1g, 5g, 100g, 500g, 25g, 500MG.
1-(bromomethyl)-4-(trifluoromethoxy)benzene (CAS 50824-05-0) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 1-(bromomethyl)-4-(trifluoromethoxy)benzene. InChIKey: JDNPUJCKXLOHOW-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 1-(bromomethyl)-4-(trifluoromethoxy)benzene |
| InChIKey | JDNPUJCKXLOHOW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)OC(F)(F)F |
Computed by PubChem (NCBI)