CAS 5097-82-5 is the registry number for 1-Phenyl-4,5-dihydro-1H-1,2,3,4-tetrazol-5-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-phenyl-1H-tetrazol-5-one (CAS 5097-82-5) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 4-phenyl-1H-tetrazol-5-one. InChIKey: FYYACQQSYSDVJB-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 4-phenyl-1H-tetrazol-5-one |
| InChIKey | FYYACQQSYSDVJB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)NN=N2 |
Computed by PubChem (NCBI)