CAS 51077-14-6 appears in our catalog under these names: N-Boc-L-azetidine-2-carboxylic Acid, 1–Boc–L–azetidine–2–carboxylic acid, Boc-L-2Aze-OH, (S)-1-(tert-Butoxycarbonyl)azetidine-2-carboxylic Acid, >98.0%(GC)(T), 1-Boc-L-azetidine-2-carboxylic acid 97%. Offered by: TRC, GLPBio, Iris Biotech, TCI, Ambeed. Available pack sizes: 1g, 2g, 500mg, 5g, 25g, 500g, 250mg, 10g.
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid (CAS 51077-14-6) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid. InChIKey: JWJVSDZKYYXDDN-LURJTMIESA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid |
| InChIKey | JWJVSDZKYYXDDN-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1C(=O)O |
Computed by PubChem (NCBI)