CAS 51084-83-4 appears in our catalog under these names: 2-Amino-1-(3-chlorophenyl)ethanone hydrochloride, 98%, 2-Amino-1-(3-chlorophenyl)ethanone hydrochloride, 2-Amino-1-(3-Chlorophenyl)Ethan-1-One Hydrochloride, 2-Amino-1-(3-chloro-phenyl)-ethanone hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 5mg, 25mg.
2-amino-1-(3-chlorophenyl)ethanone;hydrochloride (CAS 51084-83-4) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 2-amino-1-(3-chlorophenyl)ethanone;hydrochloride. InChIKey: ORPJIXJTXWDVRY-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 2-amino-1-(3-chlorophenyl)ethanone;hydrochloride |
| InChIKey | ORPJIXJTXWDVRY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)CN.Cl |
Computed by PubChem (NCBI)