CAS 51091-84-0 appears in our catalog under these names: (S)-(+)-Naproxen Chloride, Naproxen chloride, 95%, 95%, (2S)-2-(6-methoxynaphthalen-2-yl)propanoyl chloride, 95%. Offered by: Chemat Brand, Biosynth, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: on request, 5g, 10g, 100mg, 250mg, 1g.
(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl chloride (CAS 51091-84-0) is a chemical compound with the molecular formula C14H13ClO2 and a molecular weight of 248.70 g/mol. IUPAC name: (2S)-2-(6-methoxynaphthalen-2-yl)propanoyl chloride. InChIKey: UODROGXCIVAQDJ-VIFPVBQESA-N.
| Molecular formula | C14H13ClO2 |
|---|---|
| Molecular weight | 248.70 g/mol |
| IUPAC name | (2S)-2-(6-methoxynaphthalen-2-yl)propanoyl chloride |
| InChIKey | UODROGXCIVAQDJ-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)Cl |
Computed by PubChem (NCBI)