Products 51095-85-3
CAS 51095-85-3 is the registry number for 2,7-Dihydrohomoerysotrine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, Get quote.
(1S,17S)-4,5,17-trimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene (CAS 51095-85-3) is a chemical compound with the molecular formula C20H27NO3 and a molecular weight of 329.4 g/mol. IUPAC name: (1S,17S)-4,5,17-trimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene. InChIKey: VFNBFPRWBICVGZ-JXFKEZNVSA-N.
| Molecular formula | C20H27NO3 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | (1S,17S)-4,5,17-trimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraene |
| InChIKey | VFNBFPRWBICVGZ-JXFKEZNVSA-N |
| SMILES | CO[C@H]1CC=C2CCN3[C@]2(C1)C4=CC(=C(C=C4CCC3)OC)OC |
Computed by PubChem (NCBI)