CAS 511272-43-8 appears in our catalog under these names: (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(pyridin-3-yl)propanoic acid, 95%, 95%, (R)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(pyridin-3-yl)propanoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-3-ylpropanoic acid (CAS 511272-43-8) is a chemical compound with the molecular formula C23H20N2O4 and a molecular weight of 388.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-3-ylpropanoic acid. InChIKey: IZXATJNDHWFETN-OAQYLSRUSA-N.
| Molecular formula | C23H20N2O4 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-3-ylpropanoic acid |
| InChIKey | IZXATJNDHWFETN-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)C4=CN=CC=C4 |
Computed by PubChem (NCBI)