Products 51163-88-3
CAS 51163-88-3 appears in our catalog under these names: cis–Methyl 4–hydroxy–5–oxopyrrolidine–2–carboxylate, methyl cis-4-hydroxy-5-oxo-pyrrolidine-2-carboxylate, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (2S,4S)-4-hydroxy-5-oxopyrrolidine-2-carboxylate (CAS 51163-88-3) is a chemical compound with the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. IUPAC name: methyl (2S,4S)-4-hydroxy-5-oxopyrrolidine-2-carboxylate. InChIKey: OKJQBJHYKVHRIS-IMJSIDKUSA-N.
| Molecular formula | C6H9NO4 |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | methyl (2S,4S)-4-hydroxy-5-oxopyrrolidine-2-carboxylate |
| InChIKey | OKJQBJHYKVHRIS-IMJSIDKUSA-N |
| SMILES | COC(=O)[C@@H]1C[C@@H](C(=O)N1)O |
Computed by PubChem (NCBI)