CAS 51212-38-5 appears in our catalog under these names: (2S,3R)-3-Phenylpyrrolidine-2-carboxylic acid hydrochloride, 95%, (2S,3R)-3-Phenylpyrrolidine-2-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(2S,3R)-3-phenylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 51212-38-5) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: (2S,3R)-3-phenylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: CUAVFLWYXFQKBH-UXQCFNEQSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | (2S,3R)-3-phenylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | CUAVFLWYXFQKBH-UXQCFNEQSA-N |
| SMILES | C1CN[C@@H]([C@H]1C2=CC=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)