Products 51226-15-4
CAS 51226-15-4 is the registry number for 3-(4,4,5,5-Tetramethyl-1,3-dioxolan-2-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)aniline (CAS 51226-15-4) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)aniline. InChIKey: LHQLVZPDWVBYBZ-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)aniline |
| InChIKey | LHQLVZPDWVBYBZ-UHFFFAOYSA-N |
| SMILES | CC1(C(OC(O1)C2=CC(=CC=C2)N)(C)C)C |
Computed by PubChem (NCBI)