CAS 51264-76-7 appears in our catalog under these names: (2-Ethoxy-4-formylphenoxy)acetic Acid, 2–(2–Ethoxy–4–formylphenoxy)acetic acid, (2-Ethoxy-4-formyl-phenoxy)-acetic acid, 2-(2-Ethoxy-4-formylphenoxy)acetic acid 97%, 2-(2-Ethoxy-4-formylphenoxy)acetic acid, 97%, 97%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2,5g, 1g, 250mg, 5g, 2g, 0,25g, 0,5g, 10g.
2-(2-ethoxy-4-formylphenoxy)acetic acid (CAS 51264-76-7) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: 2-(2-ethoxy-4-formylphenoxy)acetic acid. InChIKey: BALVFSVIEQRSSY-UHFFFAOYSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 2-(2-ethoxy-4-formylphenoxy)acetic acid |
| InChIKey | BALVFSVIEQRSSY-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C=O)OCC(=O)O |
Computed by PubChem (NCBI)