CAS 51268-23-6 appears in our catalog under these names: (R,R)-Cyclohex-4-ene-1,2-dicarboxylic anhydride, 98%, (R,R)-Cyclohex-4-ene-1,2-dicarboxylic anhydride. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1000mg, 5000mg.
(3aR,7aR)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (CAS 51268-23-6) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. IUPAC name: (3aR,7aR)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione. InChIKey: KMOUUZVZFBCRAM-PHDIDXHHSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | (3aR,7aR)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| InChIKey | KMOUUZVZFBCRAM-PHDIDXHHSA-N |
| SMILES | C1C=CC[C@@H]2[C@@H]1C(=O)OC2=O |
Computed by PubChem (NCBI)