CAS 89614-23-3 appears in our catalog under these names: 1,2,3,6-Tetrahydrophthalic Anhydride-3,3,4,5,6,6-D₆ (Technical Grade), 1,2,3,6-Tetrahydrophthalic anhydride-3,3,4,5,6,6-d6. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 250mg.
4,4,5,6,7,7-hexadeuterio-3a,7a-dihydro-2-benzofuran-1,3-dione (CAS 89614-23-3) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 158.18 g/mol. IUPAC name: 4,4,5,6,7,7-hexadeuterio-3a,7a-dihydro-2-benzofuran-1,3-dione. InChIKey: KMOUUZVZFBCRAM-TZCZJOIZSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 158.18 g/mol |
| IUPAC name | 4,4,5,6,7,7-hexadeuterio-3a,7a-dihydro-2-benzofuran-1,3-dione |
| InChIKey | KMOUUZVZFBCRAM-TZCZJOIZSA-N |
| SMILES | [2H]C1=C(C(C2C(C1([2H])[2H])C(=O)OC2=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)