CAS 935-79-5 appears in our catalog under these names: Cis-1,2,3,6-tetrahydrophthalic anhydride, 98%, cis-1,2,3,6-Tetrahydrophthalic Anhydride, cis-4-Cyclohexene-1,2-dicarboxylic anhydride, 95% , cis-4-Cyclohexene-1,2-dicarboxylic Anhydride, >98.0%(GC)(T), CIS-1,2,3,6-TETRAHYDROPHTHALIC ANHYDRID&. Offered by: Combi-blocks, TRC, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 5g, 100g, 500g, 1kg, 25g, 10g, 50g, 250g.
(3aR,7aS)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (CAS 935-79-5) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. IUPAC name: (3aR,7aS)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione. InChIKey: KMOUUZVZFBCRAM-OLQVQODUSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | (3aR,7aS)-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| InChIKey | KMOUUZVZFBCRAM-OLQVQODUSA-N |
| SMILES | C1C=CC[C@H]2[C@@H]1C(=O)OC2=O |
Computed by PubChem (NCBI)