Products 512809-80-2

CAS 512809-80-2 is the registry number for 2-(3-(3,5-Dimethyl-1H-pyrazol-4-yl)adamantan-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-[3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-adamantyl]acetic acid (CAS 512809-80-2) is a chemical compound with the molecular formula C17H24N2O2 and a molecular weight of 288.4 g/mol. IUPAC name: 2-[3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-adamantyl]acetic acid. InChIKey: BXGTVFWQTAHJCR-UHFFFAOYSA-N.

Identity
Molecular formulaC17H24N2O2
Molecular weight288.4 g/mol
IUPAC name2-[3-(3,5-dimethyl-1H-pyrazol-4-yl)-1-adamantyl]acetic acid
InChIKeyBXGTVFWQTAHJCR-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1)C)C23CC4CC(C2)CC(C4)(C3)CC(=O)O

Computed by PubChem (NCBI)