CAS 512810-10-5 is the registry number for 1-((2,6-Dichlorophenyl)methyl)-1H-pyrazol-4-amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-[(2,6-dichlorophenyl)methyl]pyrazol-4-amine (CAS 512810-10-5) is a chemical compound with the molecular formula C10H9Cl2N3 and a molecular weight of 242.10 g/mol. IUPAC name: 1-[(2,6-dichlorophenyl)methyl]pyrazol-4-amine. InChIKey: WOBWJVUNZSZELK-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N3 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 1-[(2,6-dichlorophenyl)methyl]pyrazol-4-amine |
| InChIKey | WOBWJVUNZSZELK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CN2C=C(C=N2)N)Cl |
Computed by PubChem (NCBI)