Products 51366-22-4

CAS 51366-22-4 is the registry number for (S)-Ethyl 2-amino-3-(4-chlorophenyl)propanoate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Ethyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride (CAS 51366-22-4) is a chemical compound with the molecular formula C11H15Cl2NO2 and a molecular weight of 264.14 g/mol. IUPAC name: ethyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride. InChIKey: FDQIKGOQYNZYOO-PPHPATTJSA-N.

Identity
Molecular formulaC11H15Cl2NO2
Molecular weight264.14 g/mol
IUPAC nameethyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride
InChIKeyFDQIKGOQYNZYOO-PPHPATTJSA-N
SMILESCCOC(=O)[C@H](CC1=CC=C(C=C1)Cl)N.Cl

Computed by PubChem (NCBI)