CAS 51366-22-4 is the registry number for (S)-Ethyl 2-amino-3-(4-chlorophenyl)propanoate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.
Ethyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride (CAS 51366-22-4) is a chemical compound with the molecular formula C11H15Cl2NO2 and a molecular weight of 264.14 g/mol. IUPAC name: ethyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride. InChIKey: FDQIKGOQYNZYOO-PPHPATTJSA-N.
| Molecular formula | C11H15Cl2NO2 |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | ethyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride |
| InChIKey | FDQIKGOQYNZYOO-PPHPATTJSA-N |
| SMILES | CCOC(=O)[C@H](CC1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)