Products 51419-59-1
CAS 51419-59-1 appears in our catalog under these names: 4–Methylbenzylsulfonyl chloride, 4-Methylbenzylsulfonyl chloride, 97%, p-Tolylmethanesulfonyl chloride 96%, 4-METHYLBENZYLSULFONYL CHLORIDE, 96%, p-Tolyl-methanesulfonyl chloride, 95%. Offered by: GLPBio, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 100g, 250mg, 10g, 25g.
(4-methylphenyl)methanesulfonyl chloride (CAS 51419-59-1) is a chemical compound with the molecular formula C8H9ClO2S and a molecular weight of 204.67 g/mol. IUPAC name: (4-methylphenyl)methanesulfonyl chloride. InChIKey: JALKUHLLMWYIAT-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO2S |
|---|---|
| Molecular weight | 204.67 g/mol |
| IUPAC name | (4-methylphenyl)methanesulfonyl chloride |
| InChIKey | JALKUHLLMWYIAT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
(4-Methylphenyl)methanesulfonyl chloride, 4-Methylbenzylsulfonyl chloride, p-Tolylmethanesulfonyl chloride, p-Tolyl-methanesulfonyl chloride, p-methylbenzylsulfonyl chloride, alpha-p-Xylenesulfonyl chloride, benzenemethanesulfonyl chloride, 4-methyl-, p-Tolyl methanesulfonyl chloride, p-Tolylmethanes, p-Tolylmethanesulfonylchloride