Products 514811-70-2

CAS 514811-70-2 is the registry number for 2-(2-(4-(tert-Butyl)benzoyl)hydrazine-1-carbonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[(4-tert-butylbenzoyl)amino]carbamoyl]benzoic acid (CAS 514811-70-2) is a chemical compound with the molecular formula C19H20N2O4 and a molecular weight of 340.4 g/mol. IUPAC name: 2-[[(4-tert-butylbenzoyl)amino]carbamoyl]benzoic acid. InChIKey: HJNZYYVKTLSACX-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20N2O4
Molecular weight340.4 g/mol
IUPAC name2-[[(4-tert-butylbenzoyl)amino]carbamoyl]benzoic acid
InChIKeyHJNZYYVKTLSACX-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)C(=O)NNC(=O)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)