Products 51490-17-6
CAS 51490-17-6 is the registry number for 6,7,8,9-Tetrahydro-5H-benzo(7)annulen-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-amine;hydrochloride (CAS 51490-17-6) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: 6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-amine;hydrochloride. InChIKey: NPDRNHXLLQFFHC-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | 6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-amine;hydrochloride |
| InChIKey | NPDRNHXLLQFFHC-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(CC1)C=C(C=C2)N.Cl |
Computed by PubChem (NCBI)