Products 51558-26-0
CAS 51558-26-0 appears in our catalog under these names: 2-(4-methoxyphenyl)-2-methylpropan-1-amine hydrochloride, 98%, 2-(4-Methoxyphenyl)-2-methylpropan-1-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g.
2-(4-methoxyphenyl)-2-methylpropan-1-amine;hydrochloride (CAS 51558-26-0) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: 2-(4-methoxyphenyl)-2-methylpropan-1-amine;hydrochloride. InChIKey: DVMZBORVZRSFJO-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-2-methylpropan-1-amine;hydrochloride |
| InChIKey | DVMZBORVZRSFJO-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)C1=CC=C(C=C1)OC.Cl |
Computed by PubChem (NCBI)