CAS 5157-10-8 is the registry number for 2-Methyl-1H-perimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-1H-perimidine (CAS 5157-10-8) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 182.22 g/mol. IUPAC name: 2-methyl-1H-perimidine. InChIKey: HJXMORWPPSSVMF-UHFFFAOYSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-methyl-1H-perimidine |
| InChIKey | HJXMORWPPSSVMF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC3=C2C(=CC=C3)N1 |
Computed by PubChem (NCBI)