CAS 68906-27-4 appears in our catalog under these names: (S)–2–Methyl–1–phenylpropan–1–amine hydrochloride, (S)-2-Methyl-1-phenylpropan-1-amine hydrochloride, 97%, 97%, (S)-2-Methyl-1-phenylpropan-1-amine hydrochloride, 95%, (S)-2-Methyl-1-phenylpropan-1-amine hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
(1S)-2-methyl-1-phenylpropan-1-amine;hydrochloride (CAS 68906-27-4) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1S)-2-methyl-1-phenylpropan-1-amine;hydrochloride. InChIKey: LZDSYIZUCSUNKJ-PPHPATTJSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1S)-2-methyl-1-phenylpropan-1-amine;hydrochloride |
| InChIKey | LZDSYIZUCSUNKJ-PPHPATTJSA-N |
| SMILES | CC(C)[C@@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)