CAS 51673-59-7 appears in our catalog under these names: 1-(2-Nitrophenyl)-1,2-ethanediol, 95%, 1-(2-Nitrophenyl)-1,2-ethanediol, 1-(2-Nitrophenyl)ethane-1,2-diol 95%, 1-(2-Nitrophenyl)-1,2-ethanediol, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 0,25g, 0,5g, 100mg, 250mg.
1-(2-nitrophenyl)ethane-1,2-diol (CAS 51673-59-7) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 1-(2-nitrophenyl)ethane-1,2-diol. InChIKey: AYVFQXVSRJXIDT-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 1-(2-nitrophenyl)ethane-1,2-diol |
| InChIKey | AYVFQXVSRJXIDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CO)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)