CAS 51719-66-5 appears in our catalog under these names: 3-Bromo-5-methylphenylacetic acid, 3-Bromo-5-methylphenylacetic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 50mg, 0,5g, 250mg, 1g.
2-(3-bromo-5-methylphenyl)acetic acid (CAS 51719-66-5) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-(3-bromo-5-methylphenyl)acetic acid. InChIKey: CLTIMCXGBQJJIQ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-(3-bromo-5-methylphenyl)acetic acid |
| InChIKey | CLTIMCXGBQJJIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)CC(=O)O |
Computed by PubChem (NCBI)