Products 51768-58-2
CAS 51768-58-2 appears in our catalog under these names: δ8–THC–ethyl, Δ8-THC-ethyl. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, Get quote.
(6aR,10aR)-3-ethyl-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol (CAS 51768-58-2) is a chemical compound with the molecular formula C18H24O2 and a molecular weight of 272.4 g/mol. IUPAC name: (6aR,10aR)-3-ethyl-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol. InChIKey: DNTBFILTGOCICF-ZIAGYGMSSA-N.
| Molecular formula | C18H24O2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (6aR,10aR)-3-ethyl-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| InChIKey | DNTBFILTGOCICF-ZIAGYGMSSA-N |
| SMILES | CCC1=CC(=C2[C@@H]3CC(=CC[C@H]3C(OC2=C1)(C)C)C)O |
Computed by PubChem (NCBI)