CAS 51814-54-1 appears in our catalog under these names: Boc-L-alanine benzylester, Boc-Ala-OBzl 97%, Boc-L-Alanine benzyl ester, 97%, 97%, Boc-L-Alanine benzyl ester, 97.90%, Boc-L-alanine benzyl ester, 95%. Offered by: Biosynth, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 500g, 10 g, 5 g.
Benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 51814-54-1) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: KZNCFIIFMFCSHL-NSHDSACASA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | KZNCFIIFMFCSHL-NSHDSACASA-N |
| SMILES | C[C@@H](C(=O)OCC1=CC=CC=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)