CAS 51903-38-9 is the registry number for Benzaldehyde, 2,4,6-trimethoxy-, oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
(NE)-N-[(2,4,6-trimethoxyphenyl)methylidene]hydroxylamine (CAS 51903-38-9) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: (NE)-N-[(2,4,6-trimethoxyphenyl)methylidene]hydroxylamine. InChIKey: UGCMJRGHQWYGCF-IZZDOVSWSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | (NE)-N-[(2,4,6-trimethoxyphenyl)methylidene]hydroxylamine |
| InChIKey | UGCMJRGHQWYGCF-IZZDOVSWSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)/C=N/O)OC |
Computed by PubChem (NCBI)