CAS 519156-32-2 appears in our catalog under these names: H–Thr(Ac)–OH · HCl, H-Thr(Ac)-OH·HCl. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g, 10000mg, 5000mg.
(2S,3R)-3-acetyloxy-2-aminobutanoic acid;hydrochloride (CAS 519156-32-2) is a chemical compound with the molecular formula C6H12ClNO4 and a molecular weight of 197.62 g/mol. IUPAC name: (2S,3R)-3-acetyloxy-2-aminobutanoic acid;hydrochloride. InChIKey: AYQYCOUDKBQYRH-ZJQZTCRYSA-N.
| Molecular formula | C6H12ClNO4 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | (2S,3R)-3-acetyloxy-2-aminobutanoic acid;hydrochloride |
| InChIKey | AYQYCOUDKBQYRH-ZJQZTCRYSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N)OC(=O)C.Cl |
Computed by PubChem (NCBI)