Products 51934-39-5
CAS 51934-39-5 appears in our catalog under these names: 7-Bromo-1-naphthoic acid, 7-Bromo-1-naphthoic acid 95%, 7-Bromo-1-naphthoic acid, 95%, 95%, 7-Bromo-1-naphthoic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g, 10g.
7-bromonaphthalene-1-carboxylic acid (CAS 51934-39-5) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 7-bromonaphthalene-1-carboxylic acid. InChIKey: OMVHZFPTYXFWFU-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 7-bromonaphthalene-1-carboxylic acid |
| InChIKey | OMVHZFPTYXFWFU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)Br)C(=C1)C(=O)O |
Computed by PubChem (NCBI)