Products 52030-86-1
CAS 52030-86-1 is the registry number for Methotrexate EP Impurity L Enantiomer. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[[4-(methylamino)benzoyl]amino]pentanedioic acid (CAS 52030-86-1) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: (2R)-2-[[4-(methylamino)benzoyl]amino]pentanedioic acid. InChIKey: UFBUCKLNZUNJHS-SNVBAGLBSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | (2R)-2-[[4-(methylamino)benzoyl]amino]pentanedioic acid |
| InChIKey | UFBUCKLNZUNJHS-SNVBAGLBSA-N |
| SMILES | CNC1=CC=C(C=C1)C(=O)N[C@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
D-Glutamic acid, N-[4-(methylamino)benzoyl]-, Methotrexate Impurity31, Methotrexate Impurity 29, N-[4-(Methylamino)benzoyl]-D-glutamic acid, (4-(methylamino)benzoyl)-D-glutamic acid, (2R)-2-[[4-(methylamino)benzoyl]amino]pentanedioic acid, 2-[[4-(methylamino)benzoyl]amino]pentanedioic acid, (2R)-