CAS 5208-93-5 appears in our catalog under these names: 3-Methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol, 95%, 3-Methyl-1-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-1,4-dien-3-ol 95%, Vinyl-beta-ionol, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.
(1E)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-ol (CAS 5208-93-5) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (1E)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-ol. InChIKey: PZGYHDPZANRCSM-PKNBQFBNSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | (1E)-3-methyl-1-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-ol |
| InChIKey | PZGYHDPZANRCSM-PKNBQFBNSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(C)(C=C)O |
Computed by PubChem (NCBI)