Products 52092-29-2
CAS 52092-29-2 appears in our catalog under these names: 2-((1R,4r)-4-phenylcyclohexyl)acetic acid, 98%, 2-((1R,4r)-4-phenylcyclohexyl)acetic acid, 98%, 98%, trans-4-Phenylcyclohexaneacetic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 50mg, 1g, 100mg, 250mg, 500mg.
2-(4-phenylcyclohexyl)acetic acid (CAS 52092-29-2) is a chemical compound with the molecular formula C14H18O2 and a molecular weight of 218.29 g/mol. IUPAC name: 2-(4-phenylcyclohexyl)acetic acid. InChIKey: PBYZBGVGPMEGRS-UHFFFAOYSA-N.
| Molecular formula | C14H18O2 |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | 2-(4-phenylcyclohexyl)acetic acid |
| InChIKey | PBYZBGVGPMEGRS-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1CC(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
2-(4-phenylcyclohexyl)acetic Acid, trans-4-Phenylcyclohexaneacetic acid, 2-((1R,4R)-4-phenylcyclohexyl)acetic acid, 2-((1s,4s)-4-phenylcyclohexyl)acetic acid, Cyclohexaneacetic acid, 4-phenyl-, trans-, rel-2-((1S,4S)-4-phenylcyclohexyl)acetic acid, (4-phenylcyclohexyl)acetic acid, Cyclohexaneacetic acid, 4-phenyl-, cis-, 4-Phenyl-cyclohexaneacetic Acid, Cyclohexaneacetic acid,4-phenyl-,trans-