Products 521068-44-0

CAS 521068-44-0 is the registry number for Ethyl 2-(3-cyanophenyl)-2-methylpropanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(3-cyanophenyl)-2-methylpropanoate (CAS 521068-44-0) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: ethyl 2-(3-cyanophenyl)-2-methylpropanoate. InChIKey: XQVYPZKYLFMKDV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO2
Molecular weight217.26 g/mol
IUPAC nameethyl 2-(3-cyanophenyl)-2-methylpropanoate
InChIKeyXQVYPZKYLFMKDV-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(C)C1=CC=CC(=C1)C#N

Computed by PubChem (NCBI)