CAS 52144-22-6 is the registry number for 4,6-Dimethoxyquinoline-2-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,6-dimethoxyquinoline-2-carboxylic acid (CAS 52144-22-6) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 4,6-dimethoxyquinoline-2-carboxylic acid. InChIKey: LAUODWAMPIXMAA-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 4,6-dimethoxyquinoline-2-carboxylic acid |
| InChIKey | LAUODWAMPIXMAA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(C=C2OC)C(=O)O |
Computed by PubChem (NCBI)