CAS 52156-50-0 is the registry number for (3-Benzyl-1,2-oxazol-5-yl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3-benzyl-1,2-oxazol-5-yl)methanol (CAS 52156-50-0) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: (3-benzyl-1,2-oxazol-5-yl)methanol. InChIKey: SKCJRQAZVNRZHY-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (3-benzyl-1,2-oxazol-5-yl)methanol |
| InChIKey | SKCJRQAZVNRZHY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NOC(=C2)CO |
Computed by PubChem (NCBI)