Products 52205-85-3
CAS 52205-85-3 appears in our catalog under these names: Indan–5–sulfonyl chloride, Indane-5-sulfonyl chloride, 97% , 2,3-Dihydro-1H-indene-5-sulfonyl chloride 98%, INDAN-5-SULFONYL CHLORIDE, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg, 10g.
2,3-dihydro-1H-indene-5-sulfonyl chloride (CAS 52205-85-3) is a chemical compound with the molecular formula C9H9ClO2S and a molecular weight of 216.68 g/mol. IUPAC name: 2,3-dihydro-1H-indene-5-sulfonyl chloride. InChIKey: SWLIXMXSCZYVTQ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2S |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | 2,3-dihydro-1H-indene-5-sulfonyl chloride |
| InChIKey | SWLIXMXSCZYVTQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,3-dihydro-1H-indene-5-sulfonyl chloride, indane-5-sulfonyl chloride, Indan-5-sulfonyl chloride, indan-5-sulfonylchloride, indane-5-sulphonyl chloride, indan-5-sulfonic acid chloride, indan-5-sulfonyl chloride, AldrichCPR, chloroindan-5-ylsulfone, orb3022938, Indan-5-sulfonyl chloride, 97%