CAS 5227-67-8 is the registry number for Anthracene-2,3-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Anthracene-2,3-diamine (CAS 5227-67-8) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: anthracene-2,3-diamine. InChIKey: WCVNBLGKFSZZFU-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | anthracene-2,3-diamine |
| InChIKey | WCVNBLGKFSZZFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C=C(C(=CC3=CC2=C1)N)N |
Computed by PubChem (NCBI)