Products 52287-41-9

CAS 52287-41-9 is the registry number for 4-Methylquinoline-7-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

4-methylquinoline-7-carboxylic acid (CAS 52287-41-9) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 4-methylquinoline-7-carboxylic acid. InChIKey: VJCBQWXTSJLFBE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO2
Molecular weight187.19 g/mol
IUPAC name4-methylquinoline-7-carboxylic acid
InChIKeyVJCBQWXTSJLFBE-UHFFFAOYSA-N
SMILESCC1=C2C=CC(=CC2=NC=C1)C(=O)O

Computed by PubChem (NCBI)