Products 52328-71-9
CAS 52328-71-9 is the registry number for 1-(4-Nitro-phenyl)-1H-indazole-3-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
1-(4-nitrophenyl)indazole-3-carboxylic acid (CAS 52328-71-9) is a chemical compound with the molecular formula C14H9N3O4 and a molecular weight of 283.24 g/mol. IUPAC name: 1-(4-nitrophenyl)indazole-3-carboxylic acid. InChIKey: LRKIVGFMSAGKRT-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O4 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 1-(4-nitrophenyl)indazole-3-carboxylic acid |
| InChIKey | LRKIVGFMSAGKRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2C3=CC=C(C=C3)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)